About 5-amino-6-ethoxy-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide
5-amino-6-ethoxy-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide (PubChem CID 90100556) has the molecular formula C9H12F3N3O3S
and a molecular weight of 299.27 g/mol. Its IUPAC name is 5-amino-6-ethoxy-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 5-amino-6-ethoxy-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide |
| PubChem CID | 90100556 |
| Molecular Formula | C9H12F3N3O3S |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 5-amino-6-ethoxy-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide |
| SMILES | CCOc1ncc(S(=O)(=O)NCC(F)(F)F)cc1N |
| InChI | InChI=1S/C9H12F3N3O3S/c1-2-18-8-7(13)3-6(4-14-8)19(16,17)15-5-9(10,11)12/h3-4,15H,2,5,13H2,1H3 |
| InChIKey | YRGHFXKMMXITIH-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-amino-6-ethoxy-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-6-ethoxy-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide?
The IUPAC name of 5-amino-6-ethoxy-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide (CID 90100556) is 5-amino-6-ethoxy-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide.
What is the SMILES notation for 5-amino-6-ethoxy-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide?
The canonical SMILES for 5-amino-6-ethoxy-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide is CCOc1ncc(S(=O)(=O)NCC(F)(F)F)cc1N.
What is the InChIKey of 5-amino-6-ethoxy-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide?
The InChIKey is YRGHFXKMMXITIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3N3O3S/c1-2-18-8-7(13)3-6(4-14-8)19(16,17)15-5-9(10,11)12/h3-4,15H,2,5,13H2,1H3.
What are the key properties of 5-amino-6-ethoxy-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide?
5-amino-6-ethoxy-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide has a molecular weight of 299.27 g/mol, XLogP of 0.90, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-6-ethoxy-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide is sourced from PubChem (CID 90100556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).