C46H38F6N14O2 — CID 90100933
1,2-bis[4-(5-methoxy-4-piperazin-1-ylpyrido[3,4-d]pyrimidin-2-yl)-2-pyridinyl]-1,2-bis(2,4,5-trifluorophenyl)hydrazine (PubChem CID 90100933) has the molecular formula C46H38F6N14O2 and a molecular weight of 932.89 g/mol. Its IUPAC name is 1,2-bis[4-(5-methoxy-4-piperazin-1-ylpyrido[3,4-d]pyrimidin-2-yl)-2-pyridinyl]-1,2-bis(2,4,5-trifluorophenyl)hydrazine.
| Compound Name | 1,2-bis[4-(5-methoxy-4-piperazin-1-ylpyrido[3,4-d]pyrimidin-2-yl)-2-pyridinyl]-1,2-bis(2,4,5-trifluorophenyl)hydrazine |
|---|---|
| PubChem CID | 90100933 |
| Molecular Formula | C46H38F6N14O2 |
| Molecular Weight | 932.89 g/mol |
| Exact Mass | 932.32 |
| IUPAC Name | 1,2-bis[4-(5-methoxy-4-piperazin-1-ylpyrido[3,4-d]pyrimidin-2-yl)-2-pyridinyl]-1,2-bis(2,4,5-trifluorophenyl)hydrazine |
| SMILES | COc1cncc2nc(-c3ccnc(N(c4cc(F)c(F)cc4F)N(c4cc(-c5nc(N6CCNCC6)c6c(OC)cncc6n5)ccn4)c4cc(F)c(F)cc4F)c3)nc(N3CCNCC3)c12 |
| InChI | InChI=1S/C46H38F6N14O2/c1-67-37-23-55-21-33-41(37)45(63-11-7-53-8-12-63)61-43(59-33)25-3-5-57-39(15-25)65(35-19-29(49)27(47)17-31(35)51)66(36-20-30(50)28(48)18-32(36)52)40-16-26(4-6-58-40)44-60-34-22-56-24-38(68-2)42(34)46(62-44)64-13-9-54-10-14-64/h3-6,15-24,53-54H,7-14H2,1-2H3 |
| InChIKey | NYKNSICWSHQTCR-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 158.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 932.89 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|