About (4-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-(3-methylimidazol-4-yl)methanol
(4-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-(3-methylimidazol-4-yl)methanol (PubChem CID 90100965) has the molecular formula C26H18Cl3N3O
and a molecular weight of 494.81 g/mol. Its IUPAC name is (4-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-(3-methylimidazol-4-yl)methanol.
Molecular Properties
| Compound Name | (4-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-(3-methylimidazol-4-yl)methanol |
| PubChem CID | 90100965 |
| Molecular Formula | C26H18Cl3N3O |
| Molecular Weight | 494.81 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | (4-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-(3-methylimidazol-4-yl)methanol |
| SMILES | Cn1cncc1C(O)(c1ccc(Cl)cc1)c1ccc2nc(Cl)c(-c3ccccc3)c(Cl)c2c1 |
| InChI | InChI=1S/C26H18Cl3N3O/c1-32-15-30-14-22(32)26(33,17-7-10-19(27)11-8-17)18-9-12-21-20(13-18)24(28)23(25(29)31-21)16-5-3-2-4-6-16/h2-15,33H,1H3 |
| InChIKey | QOYQIWQMFXCUDP-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.81 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-(3-methylimidazol-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-(3-methylimidazol-4-yl)methanol?
The IUPAC name of (4-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-(3-methylimidazol-4-yl)methanol (CID 90100965) is (4-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-(3-methylimidazol-4-yl)methanol.
What is the SMILES notation for (4-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-(3-methylimidazol-4-yl)methanol?
The canonical SMILES for (4-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-(3-methylimidazol-4-yl)methanol is Cn1cncc1C(O)(c1ccc(Cl)cc1)c1ccc2nc(Cl)c(-c3ccccc3)c(Cl)c2c1.
What is the InChIKey of (4-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-(3-methylimidazol-4-yl)methanol?
The InChIKey is QOYQIWQMFXCUDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H18Cl3N3O/c1-32-15-30-14-22(32)26(33,17-7-10-19(27)11-8-17)18-9-12-21-20(13-18)24(28)23(25(29)31-21)16-5-3-2-4-6-16/h2-15,33H,1H3.
What are the key properties of (4-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-(3-methylimidazol-4-yl)methanol?
(4-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-(3-methylimidazol-4-yl)methanol has a molecular weight of 494.81 g/mol, XLogP of 6.88, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)-(2,4-dichloro-3-phenylquinolin-6-yl)-(3-methylimidazol-4-yl)methanol is sourced from PubChem (CID 90100965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).