C20H24ClF3N4O2 — CID 90101002
4-chloro-2-(2-methyl-4-piperidin-4-ylpyrimidin-5-yl)-1-[[6-(trifluoromethyl)-2-pyridinyl]oxy]butan-2-ol (PubChem CID 90101002) has the molecular formula C20H24ClF3N4O2 and a molecular weight of 444.89 g/mol. Its IUPAC name is 4-chloro-2-(2-methyl-4-piperidin-4-ylpyrimidin-5-yl)-1-[[6-(trifluoromethyl)-2-pyridinyl]oxy]butan-2-ol.
| Compound Name | 4-chloro-2-(2-methyl-4-piperidin-4-ylpyrimidin-5-yl)-1-[[6-(trifluoromethyl)-2-pyridinyl]oxy]butan-2-ol |
|---|---|
| PubChem CID | 90101002 |
| Molecular Formula | C20H24ClF3N4O2 |
| Molecular Weight | 444.89 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 4-chloro-2-(2-methyl-4-piperidin-4-ylpyrimidin-5-yl)-1-[[6-(trifluoromethyl)-2-pyridinyl]oxy]butan-2-ol |
| SMILES | Cc1ncc(C(O)(CCCl)COc2cccc(C(F)(F)F)n2)c(C2CCNCC2)n1 |
| InChI | InChI=1S/C20H24ClF3N4O2/c1-13-26-11-15(18(27-13)14-5-9-25-10-6-14)19(29,7-8-21)12-30-17-4-2-3-16(28-17)20(22,23)24/h2-4,11,14,25,29H,5-10,12H2,1H3 |
| InChIKey | NHGMYSXYULKQBI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 80.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.89 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|