About 6-chloro-2,3-dihydro-1H-pyrano[2,3-c]isoquinoline
6-chloro-2,3-dihydro-1H-pyrano[2,3-c]isoquinoline (PubChem CID 90101355) has the molecular formula C12H10ClNO
and a molecular weight of 219.67 g/mol. Its IUPAC name is 6-chloro-2,3-dihydro-1H-pyrano[2,3-c]isoquinoline.
Molecular Properties
| Compound Name | 6-chloro-2,3-dihydro-1H-pyrano[2,3-c]isoquinoline |
| PubChem CID | 90101355 |
| Molecular Formula | C12H10ClNO |
| Molecular Weight | 219.67 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 6-chloro-2,3-dihydro-1H-pyrano[2,3-c]isoquinoline |
| SMILES | Clc1nc2c(c3ccccc13)CCCO2 |
| InChI | InChI=1S/C12H10ClNO/c13-11-9-5-2-1-4-8(9)10-6-3-7-15-12(10)14-11/h1-2,4-5H,3,6-7H2 |
| InChIKey | YYKLQVLXZMACER-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.67 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-2,3-dihydro-1H-pyrano[2,3-c]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2,3-dihydro-1H-pyrano[2,3-c]isoquinoline?
The IUPAC name of 6-chloro-2,3-dihydro-1H-pyrano[2,3-c]isoquinoline (CID 90101355) is 6-chloro-2,3-dihydro-1H-pyrano[2,3-c]isoquinoline.
What is the SMILES notation for 6-chloro-2,3-dihydro-1H-pyrano[2,3-c]isoquinoline?
The canonical SMILES for 6-chloro-2,3-dihydro-1H-pyrano[2,3-c]isoquinoline is Clc1nc2c(c3ccccc13)CCCO2.
What is the InChIKey of 6-chloro-2,3-dihydro-1H-pyrano[2,3-c]isoquinoline?
The InChIKey is YYKLQVLXZMACER-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClNO/c13-11-9-5-2-1-4-8(9)10-6-3-7-15-12(10)14-11/h1-2,4-5H,3,6-7H2.
What are the key properties of 6-chloro-2,3-dihydro-1H-pyrano[2,3-c]isoquinoline?
6-chloro-2,3-dihydro-1H-pyrano[2,3-c]isoquinoline has a molecular weight of 219.67 g/mol, XLogP of 3.21, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2,3-dihydro-1H-pyrano[2,3-c]isoquinoline is sourced from PubChem (CID 90101355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).