C12H9ClFN3O — CID 901016
1-(5-chloro-2-pyridinyl)-3-(2-fluorophenyl)urea (PubChem CID 901016) has the molecular formula C12H9ClFN3O and a molecular weight of 265.68 g/mol. Its IUPAC name is 1-(5-chloro-2-pyridinyl)-3-(2-fluorophenyl)urea.
| Compound Name | 1-(5-chloro-2-pyridinyl)-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 901016 |
| Molecular Formula | C12H9ClFN3O |
| Molecular Weight | 265.68 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 1-(5-chloro-2-pyridinyl)-3-(2-fluorophenyl)urea |
| SMILES | O=C(Nc1ccc(Cl)cn1)Nc1ccccc1F |
| InChI | InChI=1S/C12H9ClFN3O/c13-8-5-6-11(15-7-8)17-12(18)16-10-4-2-1-3-9(10)14/h1-7H,(H2,15,16,17,18) |
| InChIKey | OXVBHSXGJAFVAU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.68 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |