C19H23N5O — CID 90101638
1-[2-(oxan-4-yl)ethyl]-5-[4-(1H-1,2,4-triazol-5-yl)phenyl]-2H-pyrazine (PubChem CID 90101638) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is 1-[2-(oxan-4-yl)ethyl]-5-[4-(1H-1,2,4-triazol-5-yl)phenyl]-2H-pyrazine.
| Compound Name | 1-[2-(oxan-4-yl)ethyl]-5-[4-(1H-1,2,4-triazol-5-yl)phenyl]-2H-pyrazine |
|---|---|
| PubChem CID | 90101638 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 1-[2-(oxan-4-yl)ethyl]-5-[4-(1H-1,2,4-triazol-5-yl)phenyl]-2H-pyrazine |
| SMILES | C1=NC(c2ccc(-c3ncn[nH]3)cc2)=CN(CCC2CCOCC2)C1 |
| InChI | InChI=1S/C19H23N5O/c1-3-17(19-21-14-22-23-19)4-2-16(1)18-13-24(10-8-20-18)9-5-15-6-11-25-12-7-15/h1-4,8,13-15H,5-7,9-12H2,(H,21,22,23) |
| InChIKey | XRSRKHKUDQCXRG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |