About (2S)-2-(2,5-difluorophenyl)-5-methylidene-3-nitrooxane
(2S)-2-(2,5-difluorophenyl)-5-methylidene-3-nitrooxane (PubChem CID 90101877) has the molecular formula C12H11F2NO3
and a molecular weight of 255.22 g/mol. Its IUPAC name is (2S)-2-(2,5-difluorophenyl)-5-methylidene-3-nitrooxane.
Molecular Properties
| Compound Name | (2S)-2-(2,5-difluorophenyl)-5-methylidene-3-nitrooxane |
| PubChem CID | 90101877 |
| Molecular Formula | C12H11F2NO3 |
| Molecular Weight | 255.22 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | (2S)-2-(2,5-difluorophenyl)-5-methylidene-3-nitrooxane |
| SMILES | C=C1CO[C@@H](c2cc(F)ccc2F)C([N+](=O)[O-])C1 |
| InChI | InChI=1S/C12H11F2NO3/c1-7-4-11(15(16)17)12(18-6-7)9-5-8(13)2-3-10(9)14/h2-3,5,11-12H,1,4,6H2/t11?,12-/m0/s1 |
| InChIKey | VEHIHEPLGDQYLG-KIYNQFGBSA-N |
| XLogP | 2.63 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.22 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-(2,5-difluorophenyl)-5-methylidene-3-nitrooxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(2,5-difluorophenyl)-5-methylidene-3-nitrooxane?
The IUPAC name of (2S)-2-(2,5-difluorophenyl)-5-methylidene-3-nitrooxane (CID 90101877) is (2S)-2-(2,5-difluorophenyl)-5-methylidene-3-nitrooxane.
What is the SMILES notation for (2S)-2-(2,5-difluorophenyl)-5-methylidene-3-nitrooxane?
The canonical SMILES for (2S)-2-(2,5-difluorophenyl)-5-methylidene-3-nitrooxane is C=C1CO[C@@H](c2cc(F)ccc2F)C([N+](=O)[O-])C1.
What is the InChIKey of (2S)-2-(2,5-difluorophenyl)-5-methylidene-3-nitrooxane?
The InChIKey is VEHIHEPLGDQYLG-KIYNQFGBSA-N. The full InChI is InChI=1S/C12H11F2NO3/c1-7-4-11(15(16)17)12(18-6-7)9-5-8(13)2-3-10(9)14/h2-3,5,11-12H,1,4,6H2/t11?,12-/m0/s1.
What are the key properties of (2S)-2-(2,5-difluorophenyl)-5-methylidene-3-nitrooxane?
(2S)-2-(2,5-difluorophenyl)-5-methylidene-3-nitrooxane has a molecular weight of 255.22 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(2,5-difluorophenyl)-5-methylidene-3-nitrooxane is sourced from PubChem (CID 90101877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).