C21H25F2N3O2 — CID 90101885
[1-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-3,4,5,6-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-6-yl]-cyclopropylmethanone (PubChem CID 90101885) has the molecular formula C21H25F2N3O2 and a molecular weight of 389.45 g/mol. Its IUPAC name is [1-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-3,4,5,6-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-6-yl]-cyclopropylmethanone.
| Compound Name | [1-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-3,4,5,6-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-6-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 90101885 |
| Molecular Formula | C21H25F2N3O2 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | [1-[(3R,5S,6R)-5-amino-6-(2,5-difluorophenyl)oxan-3-yl]-3,4,5,6-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-6-yl]-cyclopropylmethanone |
| SMILES | N[C@H]1C[C@@H](N2CCC3=C2C(C(=O)C2CC2)CN3)CO[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C21H25F2N3O2/c22-12-3-4-16(23)14(7-12)21-17(24)8-13(10-28-21)26-6-5-18-19(26)15(9-25-18)20(27)11-1-2-11/h3-4,7,11,13,15,17,21,25H,1-2,5-6,8-10,24H2/t13-,15?,17+,21-/m1/s1 |
| InChIKey | KKYKQXWBOTYVTM-QCZYLFBQSA-N |
| XLogP | 2.24 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |