C20H30O3 — CID 90101901
(4aS,7S,7aR)-4,7-dimethyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[c]pyran-1-one;(1S,3R,5S)-6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptan-3-ol (PubChem CID 90101901) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (4aS,7S,7aR)-4,7-dimethyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[c]pyran-1-one;(1S,3R,5S)-6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptan-3-ol.
| Compound Name | (4aS,7S,7aR)-4,7-dimethyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[c]pyran-1-one;(1S,3R,5S)-6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptan-3-ol |
|---|---|
| PubChem CID | 90101901 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (4aS,7S,7aR)-4,7-dimethyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[c]pyran-1-one;(1S,3R,5S)-6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptan-3-ol |
| SMILES | C=C1[C@H](O)C[C@@H]2C[C@H]1C2(C)C.CC1=COC(=O)[C@H]2[C@@H]1CC[C@@H]2C |
| InChI | InChI=1S/C10H14O2.C10H16O/c1-6-3-4-8-7(2)5-12-10(11)9(6)8;1-6-8-4-7(5-9(6)11)10(8,2)3/h5-6,8-9H,3-4H2,1-2H3;7-9,11H,1,4-5H2,2-3H3/t6-,8+,9+;7-,8+,9+/m00/s1 |
| InChIKey | VKHOTACDIIZOJH-PSGLYZSISA-N |
| XLogP | 4.08 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|