About 2-methoxy-N,2-dimethyl-3H-1,3-thiazole-4-carboxamide
2-methoxy-N,2-dimethyl-3H-1,3-thiazole-4-carboxamide (PubChem CID 90101941) has the molecular formula C7H12N2O2S
and a molecular weight of 188.25 g/mol. Its IUPAC name is 2-methoxy-N,2-dimethyl-3H-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-methoxy-N,2-dimethyl-3H-1,3-thiazole-4-carboxamide |
| PubChem CID | 90101941 |
| Molecular Formula | C7H12N2O2S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 2-methoxy-N,2-dimethyl-3H-1,3-thiazole-4-carboxamide |
| SMILES | CNC(=O)C1=CSC(C)(OC)N1 |
| InChI | InChI=1S/C7H12N2O2S/c1-7(11-3)9-5(4-12-7)6(10)8-2/h4,9H,1-3H3,(H,8,10) |
| InChIKey | VYTGFGLGIDTOOZ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methoxy-N,2-dimethyl-3H-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N,2-dimethyl-3H-1,3-thiazole-4-carboxamide?
The IUPAC name of 2-methoxy-N,2-dimethyl-3H-1,3-thiazole-4-carboxamide (CID 90101941) is 2-methoxy-N,2-dimethyl-3H-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2-methoxy-N,2-dimethyl-3H-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2-methoxy-N,2-dimethyl-3H-1,3-thiazole-4-carboxamide is CNC(=O)C1=CSC(C)(OC)N1.
What is the InChIKey of 2-methoxy-N,2-dimethyl-3H-1,3-thiazole-4-carboxamide?
The InChIKey is VYTGFGLGIDTOOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2S/c1-7(11-3)9-5(4-12-7)6(10)8-2/h4,9H,1-3H3,(H,8,10).
What are the key properties of 2-methoxy-N,2-dimethyl-3H-1,3-thiazole-4-carboxamide?
2-methoxy-N,2-dimethyl-3H-1,3-thiazole-4-carboxamide has a molecular weight of 188.25 g/mol, XLogP of 0.23, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N,2-dimethyl-3H-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 90101941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).