C22H36O2SeSi — CID 90102025
(1S,2R,4R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-phenylselanyl-4-prop-1-en-2-ylcyclohexan-1-ol (PubChem CID 90102025) has the molecular formula C22H36O2SeSi and a molecular weight of 439.57 g/mol. Its IUPAC name is (1S,2R,4R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-phenylselanyl-4-prop-1-en-2-ylcyclohexan-1-ol.
| Compound Name | (1S,2R,4R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-phenylselanyl-4-prop-1-en-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 90102025 |
| Molecular Formula | C22H36O2SeSi |
| Molecular Weight | 439.57 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | (1S,2R,4R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-phenylselanyl-4-prop-1-en-2-ylcyclohexan-1-ol |
| SMILES | C=C(C)[C@@H]1CC[C@](O)(CO[Si](C)(C)C(C)(C)C)[C@H]([Se]c2ccccc2)C1 |
| InChI | InChI=1S/C22H36O2SeSi/c1-17(2)18-13-14-22(23,16-24-26(6,7)21(3,4)5)20(15-18)25-19-11-9-8-10-12-19/h8-12,18,20,23H,1,13-16H2,2-7H3/t18-,20-,22+/m1/s1 |
| InChIKey | WLACLBMGIHBDMB-UZKOGDIHSA-N |
| XLogP | 4.93 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.57 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|