C27H32BrClF3N7O4 — CID 90102027
[3-[4-[[4-[[4-(3-bromopropoxy)-3-chlorophenyl]methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]anilino]-2,2-dimethylpropyl]carbamic acid (PubChem CID 90102027) has the molecular formula C27H32BrClF3N7O4 and a molecular weight of 690.95 g/mol. Its IUPAC name is [3-[4-[[4-[[4-(3-bromopropoxy)-3-chlorophenyl]methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]anilino]-2,2-dimethylpropyl]carbamic acid.
| Compound Name | [3-[4-[[4-[[4-(3-bromopropoxy)-3-chlorophenyl]methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]anilino]-2,2-dimethylpropyl]carbamic acid |
|---|---|
| PubChem CID | 90102027 |
| Molecular Formula | C27H32BrClF3N7O4 |
| Molecular Weight | 690.95 g/mol |
| Exact Mass | 689.13 |
| IUPAC Name | [3-[4-[[4-[[4-(3-bromopropoxy)-3-chlorophenyl]methylamino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]anilino]-2,2-dimethylpropyl]carbamic acid |
| SMILES | CC(C)(CNC(=O)O)CNc1ccc(Nc2nc(NCc3ccc(OCCCBr)c(Cl)c3)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C27H32BrClF3N7O4/c1-26(2,15-35-25(40)41)14-34-18-5-7-19(8-6-18)36-23-37-22(38-24(39-23)43-16-27(30,31)32)33-13-17-4-9-21(20(29)12-17)42-11-3-10-28/h4-9,12,34-35H,3,10-11,13-16H2,1-2H3,(H,40,41)(H2,33,36,37,38,39) |
| InChIKey | IQOLOCSWLPDRGU-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 142.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.95 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|