About 3-bromo-1-butylpyrazole
3-bromo-1-butylpyrazole (PubChem CID 90102192) has the molecular formula C7H11BrN2
and a molecular weight of 203.08 g/mol. Its IUPAC name is 3-bromo-1-butylpyrazole.
Molecular Properties
| Compound Name | 3-bromo-1-butylpyrazole |
| PubChem CID | 90102192 |
| Molecular Formula | C7H11BrN2 |
| Molecular Weight | 203.08 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | 3-bromo-1-butylpyrazole |
| SMILES | CCCCn1ccc(Br)n1 |
| InChI | InChI=1S/C7H11BrN2/c1-2-3-5-10-6-4-7(8)9-10/h4,6H,2-3,5H2,1H3 |
| InChIKey | OEVHVJXIQFBULZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.08 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-1-butylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1-butylpyrazole?
The IUPAC name of 3-bromo-1-butylpyrazole (CID 90102192) is 3-bromo-1-butylpyrazole.
What is the SMILES notation for 3-bromo-1-butylpyrazole?
The canonical SMILES for 3-bromo-1-butylpyrazole is CCCCn1ccc(Br)n1.
What is the InChIKey of 3-bromo-1-butylpyrazole?
The InChIKey is OEVHVJXIQFBULZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11BrN2/c1-2-3-5-10-6-4-7(8)9-10/h4,6H,2-3,5H2,1H3.
What are the key properties of 3-bromo-1-butylpyrazole?
3-bromo-1-butylpyrazole has a molecular weight of 203.08 g/mol, XLogP of 2.45, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1-butylpyrazole is sourced from PubChem (CID 90102192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).