About trimethylsilyl 2-amino-3,3-dimethylbutanoate
trimethylsilyl 2-amino-3,3-dimethylbutanoate (PubChem CID 90102815) has the molecular formula C9H21NO2Si
and a molecular weight of 203.36 g/mol. Its IUPAC name is trimethylsilyl 2-amino-3,3-dimethylbutanoate.
Molecular Properties
| Compound Name | trimethylsilyl 2-amino-3,3-dimethylbutanoate |
| PubChem CID | 90102815 |
| Molecular Formula | C9H21NO2Si |
| Molecular Weight | 203.36 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | trimethylsilyl 2-amino-3,3-dimethylbutanoate |
| SMILES | CC(C)(C)C(N)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C9H21NO2Si/c1-9(2,3)7(10)8(11)12-13(4,5)6/h7H,10H2,1-6H3 |
| InChIKey | CHFUINYVQDMKDH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethylsilyl 2-amino-3,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylsilyl 2-amino-3,3-dimethylbutanoate?
The IUPAC name of trimethylsilyl 2-amino-3,3-dimethylbutanoate (CID 90102815) is trimethylsilyl 2-amino-3,3-dimethylbutanoate.
What is the SMILES notation for trimethylsilyl 2-amino-3,3-dimethylbutanoate?
The canonical SMILES for trimethylsilyl 2-amino-3,3-dimethylbutanoate is CC(C)(C)C(N)C(=O)O[Si](C)(C)C.
What is the InChIKey of trimethylsilyl 2-amino-3,3-dimethylbutanoate?
The InChIKey is CHFUINYVQDMKDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21NO2Si/c1-9(2,3)7(10)8(11)12-13(4,5)6/h7H,10H2,1-6H3.
What are the key properties of trimethylsilyl 2-amino-3,3-dimethylbutanoate?
trimethylsilyl 2-amino-3,3-dimethylbutanoate has a molecular weight of 203.36 g/mol, XLogP of 1.74, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylsilyl 2-amino-3,3-dimethylbutanoate is sourced from PubChem (CID 90102815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).