About 4-[(5,6-dimethyl-2-pyridinyl)amino]-6-oxo-1H-pyridazine-3-carboxamide
4-[(5,6-dimethyl-2-pyridinyl)amino]-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 90103288) has the molecular formula C12H13N5O2
and a molecular weight of 259.27 g/mol. Its IUPAC name is 4-[(5,6-dimethyl-2-pyridinyl)amino]-6-oxo-1H-pyridazine-3-carboxamide.
Molecular Properties
| Compound Name | 4-[(5,6-dimethyl-2-pyridinyl)amino]-6-oxo-1H-pyridazine-3-carboxamide |
| PubChem CID | 90103288 |
| Molecular Formula | C12H13N5O2 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 4-[(5,6-dimethyl-2-pyridinyl)amino]-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | Cc1ccc(Nc2cc(=O)[nH]nc2C(N)=O)nc1C |
| InChI | InChI=1S/C12H13N5O2/c1-6-3-4-9(14-7(6)2)15-8-5-10(18)16-17-11(8)12(13)19/h3-5H,1-2H3,(H2,13,19)(H2,14,15,16,18) |
| InChIKey | PJVSFWSMWSNBFD-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(5,6-dimethyl-2-pyridinyl)amino]-6-oxo-1H-pyridazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5,6-dimethyl-2-pyridinyl)amino]-6-oxo-1H-pyridazine-3-carboxamide?
The IUPAC name of 4-[(5,6-dimethyl-2-pyridinyl)amino]-6-oxo-1H-pyridazine-3-carboxamide (CID 90103288) is 4-[(5,6-dimethyl-2-pyridinyl)amino]-6-oxo-1H-pyridazine-3-carboxamide.
What is the SMILES notation for 4-[(5,6-dimethyl-2-pyridinyl)amino]-6-oxo-1H-pyridazine-3-carboxamide?
The canonical SMILES for 4-[(5,6-dimethyl-2-pyridinyl)amino]-6-oxo-1H-pyridazine-3-carboxamide is Cc1ccc(Nc2cc(=O)[nH]nc2C(N)=O)nc1C.
What is the InChIKey of 4-[(5,6-dimethyl-2-pyridinyl)amino]-6-oxo-1H-pyridazine-3-carboxamide?
The InChIKey is PJVSFWSMWSNBFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N5O2/c1-6-3-4-9(14-7(6)2)15-8-5-10(18)16-17-11(8)12(13)19/h3-5H,1-2H3,(H2,13,19)(H2,14,15,16,18).
What are the key properties of 4-[(5,6-dimethyl-2-pyridinyl)amino]-6-oxo-1H-pyridazine-3-carboxamide?
4-[(5,6-dimethyl-2-pyridinyl)amino]-6-oxo-1H-pyridazine-3-carboxamide has a molecular weight of 259.27 g/mol, XLogP of 0.62, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5,6-dimethyl-2-pyridinyl)amino]-6-oxo-1H-pyridazine-3-carboxamide is sourced from PubChem (CID 90103288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).