C12H8F3N3O4S — CID 901034
6-[[2-nitro-4-(trifluoromethyl)phenyl]sulfanylmethyl]-1H-pyrimidine-2,4-dione (PubChem CID 901034) has the molecular formula C12H8F3N3O4S and a molecular weight of 347.27 g/mol. Its IUPAC name is 6-[[2-nitro-4-(trifluoromethyl)phenyl]sulfanylmethyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[[2-nitro-4-(trifluoromethyl)phenyl]sulfanylmethyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 901034 |
| Molecular Formula | C12H8F3N3O4S |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 6-[[2-nitro-4-(trifluoromethyl)phenyl]sulfanylmethyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1cc(CSc2ccc(C(F)(F)F)cc2[N+](=O)[O-])[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C12H8F3N3O4S/c13-12(14,15)6-1-2-9(8(3-6)18(21)22)23-5-7-4-10(19)17-11(20)16-7/h1-4H,5H2,(H2,16,17,19,20) |
| InChIKey | WEQIOXUFIYMKAA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 108.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|