C19H16O7 — CID 90103861
2,3,4,6-tetrahydroxy-1-methoxy-7,8,9,10-tetrahydrotetracene-5,12-dione (PubChem CID 90103861) has the molecular formula C19H16O7 and a molecular weight of 356.33 g/mol. Its IUPAC name is 2,3,4,6-tetrahydroxy-1-methoxy-7,8,9,10-tetrahydrotetracene-5,12-dione.
| Compound Name | 2,3,4,6-tetrahydroxy-1-methoxy-7,8,9,10-tetrahydrotetracene-5,12-dione |
|---|---|
| PubChem CID | 90103861 |
| Molecular Formula | C19H16O7 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 2,3,4,6-tetrahydroxy-1-methoxy-7,8,9,10-tetrahydrotetracene-5,12-dione |
| SMILES | COc1c(O)c(O)c(O)c2c1C(=O)c1cc3c(c(O)c1C2=O)CCCC3 |
| InChI | InChI=1S/C19H16O7/c1-26-19-12-11(16(23)17(24)18(19)25)15(22)10-9(14(12)21)6-7-4-2-3-5-8(7)13(10)20/h6,20,23-25H,2-5H2,1H3 |
| InChIKey | GFIJHKNVDUNJNQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|