About benzene-1,2-diol;1H-pyrrole
benzene-1,2-diol;1H-pyrrole (PubChem CID 90104055) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is benzene-1,2-diol;1H-pyrrole.
Molecular Properties
| Compound Name | benzene-1,2-diol;1H-pyrrole |
| PubChem CID | 90104055 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | benzene-1,2-diol;1H-pyrrole |
| SMILES | Oc1ccccc1O.c1cc[nH]c1 |
| InChI | InChI=1S/C6H6O2.C4H5N/c7-5-3-1-2-4-6(5)8;1-2-4-5-3-1/h1-4,7-8H;1-5H |
| InChIKey | MRBYQJTUMDEVOW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,2-diol;1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2-diol;1H-pyrrole?
The IUPAC name of benzene-1,2-diol;1H-pyrrole (CID 90104055) is benzene-1,2-diol;1H-pyrrole.
What is the SMILES notation for benzene-1,2-diol;1H-pyrrole?
The canonical SMILES for benzene-1,2-diol;1H-pyrrole is Oc1ccccc1O.c1cc[nH]c1.
What is the InChIKey of benzene-1,2-diol;1H-pyrrole?
The InChIKey is MRBYQJTUMDEVOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.C4H5N/c7-5-3-1-2-4-6(5)8;1-2-4-5-3-1/h1-4,7-8H;1-5H.
What are the key properties of benzene-1,2-diol;1H-pyrrole?
benzene-1,2-diol;1H-pyrrole has a molecular weight of 177.20 g/mol, XLogP of 2.11, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2-diol;1H-pyrrole is sourced from PubChem (CID 90104055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).