C17H19BFN3O2 — CID 90104895
4-fluoro-2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]benzonitrile (PubChem CID 90104895) has the molecular formula C17H19BFN3O2 and a molecular weight of 327.17 g/mol. Its IUPAC name is 4-fluoro-2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]benzonitrile.
| Compound Name | 4-fluoro-2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 90104895 |
| Molecular Formula | C17H19BFN3O2 |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 4-fluoro-2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]benzonitrile |
| SMILES | CC1(C)OB(c2cnn(Cc3cc(F)ccc3C#N)c2)OC1(C)C |
| InChI | InChI=1S/C17H19BFN3O2/c1-16(2)17(3,4)24-18(23-16)14-9-21-22(11-14)10-13-7-15(19)6-5-12(13)8-20/h5-7,9,11H,10H2,1-4H3 |
| InChIKey | AWNHLXYKFVQQJJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 60.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|