C20H19ClN2O2 — CID 90104947
[5-[2-(3-chlorophenyl)ethynyl]-2-pyridinyl]-(3,3-dimethylmorpholin-4-yl)methanone (PubChem CID 90104947) has the molecular formula C20H19ClN2O2 and a molecular weight of 354.84 g/mol. Its IUPAC name is [5-[2-(3-chlorophenyl)ethynyl]-2-pyridinyl]-(3,3-dimethylmorpholin-4-yl)methanone.
| Compound Name | [5-[2-(3-chlorophenyl)ethynyl]-2-pyridinyl]-(3,3-dimethylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 90104947 |
| Molecular Formula | C20H19ClN2O2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | [5-[2-(3-chlorophenyl)ethynyl]-2-pyridinyl]-(3,3-dimethylmorpholin-4-yl)methanone |
| SMILES | CC1(C)COCCN1C(=O)c1ccc(C#Cc2cccc(Cl)c2)cn1 |
| InChI | InChI=1S/C20H19ClN2O2/c1-20(2)14-25-11-10-23(20)19(24)18-9-8-16(13-22-18)7-6-15-4-3-5-17(21)12-15/h3-5,8-9,12-13H,10-11,14H2,1-2H3 |
| InChIKey | TVVKRRYSXWSDJT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|