About 6-bromo-5-methylimidazo[1,2-a]pyridin-8-amine
6-bromo-5-methylimidazo[1,2-a]pyridin-8-amine (PubChem CID 90105153) has the molecular formula C8H8BrN3
and a molecular weight of 226.08 g/mol. Its IUPAC name is 6-bromo-5-methylimidazo[1,2-a]pyridin-8-amine.
Molecular Properties
| Compound Name | 6-bromo-5-methylimidazo[1,2-a]pyridin-8-amine |
| PubChem CID | 90105153 |
| Molecular Formula | C8H8BrN3 |
| Molecular Weight | 226.08 g/mol |
| Exact Mass | 224.99 |
| IUPAC Name | 6-bromo-5-methylimidazo[1,2-a]pyridin-8-amine |
| SMILES | Cc1c(Br)cc(N)c2nccn12 |
| InChI | InChI=1S/C8H8BrN3/c1-5-6(9)4-7(10)8-11-2-3-12(5)8/h2-4H,10H2,1H3 |
| InChIKey | FTHYSGXGPWCZON-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.08 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-5-methylimidazo[1,2-a]pyridin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-5-methylimidazo[1,2-a]pyridin-8-amine?
The IUPAC name of 6-bromo-5-methylimidazo[1,2-a]pyridin-8-amine (CID 90105153) is 6-bromo-5-methylimidazo[1,2-a]pyridin-8-amine.
What is the SMILES notation for 6-bromo-5-methylimidazo[1,2-a]pyridin-8-amine?
The canonical SMILES for 6-bromo-5-methylimidazo[1,2-a]pyridin-8-amine is Cc1c(Br)cc(N)c2nccn12.
What is the InChIKey of 6-bromo-5-methylimidazo[1,2-a]pyridin-8-amine?
The InChIKey is FTHYSGXGPWCZON-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrN3/c1-5-6(9)4-7(10)8-11-2-3-12(5)8/h2-4H,10H2,1H3.
What are the key properties of 6-bromo-5-methylimidazo[1,2-a]pyridin-8-amine?
6-bromo-5-methylimidazo[1,2-a]pyridin-8-amine has a molecular weight of 226.08 g/mol, XLogP of 1.99, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-5-methylimidazo[1,2-a]pyridin-8-amine is sourced from PubChem (CID 90105153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).