About 4-[4-[(1S,3S)-3-methoxycyclopentyl]sulfonyl-3-(trifluoromethyl)phenyl]morpholine
4-[4-[(1S,3S)-3-methoxycyclopentyl]sulfonyl-3-(trifluoromethyl)phenyl]morpholine (PubChem CID 90105403) has the molecular formula C17H22F3NO4S
and a molecular weight of 393.43 g/mol. Its IUPAC name is 4-[4-[(1S,3S)-3-methoxycyclopentyl]sulfonyl-3-(trifluoromethyl)phenyl]morpholine.
Molecular Properties
| Compound Name | 4-[4-[(1S,3S)-3-methoxycyclopentyl]sulfonyl-3-(trifluoromethyl)phenyl]morpholine |
| PubChem CID | 90105403 |
| Molecular Formula | C17H22F3NO4S |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 4-[4-[(1S,3S)-3-methoxycyclopentyl]sulfonyl-3-(trifluoromethyl)phenyl]morpholine |
| SMILES | CO[C@H]1CC[C@H](S(=O)(=O)c2ccc(N3CCOCC3)cc2C(F)(F)F)C1 |
| InChI | InChI=1S/C17H22F3NO4S/c1-24-13-3-4-14(11-13)26(22,23)16-5-2-12(10-15(16)17(18,19)20)21-6-8-25-9-7-21/h2,5,10,13-14H,3-4,6-9,11H2,1H3/t13-,14-/m0/s1 |
| InChIKey | LQSUVMLXANEOES-KBPBESRZSA-N |
| XLogP | 2.88 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[4-[(1S,3S)-3-methoxycyclopentyl]sulfonyl-3-(trifluoromethyl)phenyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(1S,3S)-3-methoxycyclopentyl]sulfonyl-3-(trifluoromethyl)phenyl]morpholine?
The IUPAC name of 4-[4-[(1S,3S)-3-methoxycyclopentyl]sulfonyl-3-(trifluoromethyl)phenyl]morpholine (CID 90105403) is 4-[4-[(1S,3S)-3-methoxycyclopentyl]sulfonyl-3-(trifluoromethyl)phenyl]morpholine.
What is the SMILES notation for 4-[4-[(1S,3S)-3-methoxycyclopentyl]sulfonyl-3-(trifluoromethyl)phenyl]morpholine?
The canonical SMILES for 4-[4-[(1S,3S)-3-methoxycyclopentyl]sulfonyl-3-(trifluoromethyl)phenyl]morpholine is CO[C@H]1CC[C@H](S(=O)(=O)c2ccc(N3CCOCC3)cc2C(F)(F)F)C1.
What is the InChIKey of 4-[4-[(1S,3S)-3-methoxycyclopentyl]sulfonyl-3-(trifluoromethyl)phenyl]morpholine?
The InChIKey is LQSUVMLXANEOES-KBPBESRZSA-N. The full InChI is InChI=1S/C17H22F3NO4S/c1-24-13-3-4-14(11-13)26(22,23)16-5-2-12(10-15(16)17(18,19)20)21-6-8-25-9-7-21/h2,5,10,13-14H,3-4,6-9,11H2,1H3/t13-,14-/m0/s1.
What are the key properties of 4-[4-[(1S,3S)-3-methoxycyclopentyl]sulfonyl-3-(trifluoromethyl)phenyl]morpholine?
4-[4-[(1S,3S)-3-methoxycyclopentyl]sulfonyl-3-(trifluoromethyl)phenyl]morpholine has a molecular weight of 393.43 g/mol, XLogP of 2.88, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(1S,3S)-3-methoxycyclopentyl]sulfonyl-3-(trifluoromethyl)phenyl]morpholine is sourced from PubChem (CID 90105403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).