About 2-oxospiro[1H-indole-3,1'-cyclopropane]-6-carbaldehyde
2-oxospiro[1H-indole-3,1'-cyclopropane]-6-carbaldehyde (PubChem CID 90105604) has the molecular formula C11H9NO2
and a molecular weight of 187.20 g/mol. Its IUPAC name is 2-oxospiro[1H-indole-3,1'-cyclopropane]-6-carbaldehyde.
Molecular Properties
| Compound Name | 2-oxospiro[1H-indole-3,1'-cyclopropane]-6-carbaldehyde |
| PubChem CID | 90105604 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 2-oxospiro[1H-indole-3,1'-cyclopropane]-6-carbaldehyde |
| SMILES | O=Cc1ccc2c(c1)NC(=O)C21CC1 |
| InChI | InChI=1S/C11H9NO2/c13-6-7-1-2-8-9(5-7)12-10(14)11(8)3-4-11/h1-2,5-6H,3-4H2,(H,12,14) |
| InChIKey | IJUYPUBVBLVDMK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-oxospiro[1H-indole-3,1'-cyclopropane]-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxospiro[1H-indole-3,1'-cyclopropane]-6-carbaldehyde?
The IUPAC name of 2-oxospiro[1H-indole-3,1'-cyclopropane]-6-carbaldehyde (CID 90105604) is 2-oxospiro[1H-indole-3,1'-cyclopropane]-6-carbaldehyde.
What is the SMILES notation for 2-oxospiro[1H-indole-3,1'-cyclopropane]-6-carbaldehyde?
The canonical SMILES for 2-oxospiro[1H-indole-3,1'-cyclopropane]-6-carbaldehyde is O=Cc1ccc2c(c1)NC(=O)C21CC1.
What is the InChIKey of 2-oxospiro[1H-indole-3,1'-cyclopropane]-6-carbaldehyde?
The InChIKey is IJUYPUBVBLVDMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO2/c13-6-7-1-2-8-9(5-7)12-10(14)11(8)3-4-11/h1-2,5-6H,3-4H2,(H,12,14).
What are the key properties of 2-oxospiro[1H-indole-3,1'-cyclopropane]-6-carbaldehyde?
2-oxospiro[1H-indole-3,1'-cyclopropane]-6-carbaldehyde has a molecular weight of 187.20 g/mol, XLogP of 1.48, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxospiro[1H-indole-3,1'-cyclopropane]-6-carbaldehyde is sourced from PubChem (CID 90105604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).