About 2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carbaldehyde
2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carbaldehyde (PubChem CID 90105679) has the molecular formula C8H8N2O2
and a molecular weight of 164.16 g/mol. Its IUPAC name is 2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carbaldehyde.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carbaldehyde |
| PubChem CID | 90105679 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carbaldehyde |
| SMILES | O=Cc1cnc2c(c1)NCCO2 |
| InChI | InChI=1S/C8H8N2O2/c11-5-6-3-7-8(10-4-6)12-2-1-9-7/h3-5,9H,1-2H2 |
| InChIKey | CBPHLTOHLGOGPA-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carbaldehyde?
The IUPAC name of 2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carbaldehyde (CID 90105679) is 2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carbaldehyde.
What is the SMILES notation for 2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carbaldehyde?
The canonical SMILES for 2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carbaldehyde is O=Cc1cnc2c(c1)NCCO2.
What is the InChIKey of 2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carbaldehyde?
The InChIKey is CBPHLTOHLGOGPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2/c11-5-6-3-7-8(10-4-6)12-2-1-9-7/h3-5,9H,1-2H2.
What are the key properties of 2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carbaldehyde?
2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carbaldehyde has a molecular weight of 164.16 g/mol, XLogP of 0.70, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-7-carbaldehyde is sourced from PubChem (CID 90105679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).