C21H36O5SSi — CID 90105839
(2S,3S,4R,5S,6R)-2-phenylsulfanyl-6-[tri(propan-2-yl)silyloxymethyl]oxane-3,4,5-triol (PubChem CID 90105839) has the molecular formula C21H36O5SSi and a molecular weight of 428.67 g/mol. Its IUPAC name is (2S,3S,4R,5S,6R)-2-phenylsulfanyl-6-[tri(propan-2-yl)silyloxymethyl]oxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5S,6R)-2-phenylsulfanyl-6-[tri(propan-2-yl)silyloxymethyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 90105839 |
| Molecular Formula | C21H36O5SSi |
| Molecular Weight | 428.67 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | (2S,3S,4R,5S,6R)-2-phenylsulfanyl-6-[tri(propan-2-yl)silyloxymethyl]oxane-3,4,5-triol |
| SMILES | CC(C)[Si](OC[C@H]1O[C@@H](Sc2ccccc2)[C@@H](O)[C@H](O)[C@@H]1O)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H36O5SSi/c1-13(2)28(14(3)4,15(5)6)25-12-17-18(22)19(23)20(24)21(26-17)27-16-10-8-7-9-11-16/h7-11,13-15,17-24H,12H2,1-6H3/t17-,18-,19-,20+,21+/m1/s1 |
| InChIKey | MTDVMRODZDBXPI-XKRYSZRTSA-N |
| XLogP | 3.78 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.67 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|