About 4-[4-[(1S,3S)-3-ethoxycyclopentyl]sulfonyl-3-(trifluoromethyl)phenyl]-1-methylpyrazole
4-[4-[(1S,3S)-3-ethoxycyclopentyl]sulfonyl-3-(trifluoromethyl)phenyl]-1-methylpyrazole (PubChem CID 90105854) has the molecular formula C18H21F3N2O3S
and a molecular weight of 402.44 g/mol. Its IUPAC name is 4-[4-[(1S,3S)-3-ethoxycyclopentyl]sulfonyl-3-(trifluoromethyl)phenyl]-1-methylpyrazole.
Molecular Properties
| Compound Name | 4-[4-[(1S,3S)-3-ethoxycyclopentyl]sulfonyl-3-(trifluoromethyl)phenyl]-1-methylpyrazole |
| PubChem CID | 90105854 |
| Molecular Formula | C18H21F3N2O3S |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 4-[4-[(1S,3S)-3-ethoxycyclopentyl]sulfonyl-3-(trifluoromethyl)phenyl]-1-methylpyrazole |
| SMILES | CCO[C@H]1CC[C@H](S(=O)(=O)c2ccc(-c3cnn(C)c3)cc2C(F)(F)F)C1 |
| InChI | InChI=1S/C18H21F3N2O3S/c1-3-26-14-5-6-15(9-14)27(24,25)17-7-4-12(8-16(17)18(19,20)21)13-10-22-23(2)11-13/h4,7-8,10-11,14-15H,3,5-6,9H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | NKZFPMGLHNHICQ-GJZGRUSLSA-N |
| XLogP | 3.84 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[4-[(1S,3S)-3-ethoxycyclopentyl]sulfonyl-3-(trifluoromethyl)phenyl]-1-methylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(1S,3S)-3-ethoxycyclopentyl]sulfonyl-3-(trifluoromethyl)phenyl]-1-methylpyrazole?
The IUPAC name of 4-[4-[(1S,3S)-3-ethoxycyclopentyl]sulfonyl-3-(trifluoromethyl)phenyl]-1-methylpyrazole (CID 90105854) is 4-[4-[(1S,3S)-3-ethoxycyclopentyl]sulfonyl-3-(trifluoromethyl)phenyl]-1-methylpyrazole.
What is the SMILES notation for 4-[4-[(1S,3S)-3-ethoxycyclopentyl]sulfonyl-3-(trifluoromethyl)phenyl]-1-methylpyrazole?
The canonical SMILES for 4-[4-[(1S,3S)-3-ethoxycyclopentyl]sulfonyl-3-(trifluoromethyl)phenyl]-1-methylpyrazole is CCO[C@H]1CC[C@H](S(=O)(=O)c2ccc(-c3cnn(C)c3)cc2C(F)(F)F)C1.
What is the InChIKey of 4-[4-[(1S,3S)-3-ethoxycyclopentyl]sulfonyl-3-(trifluoromethyl)phenyl]-1-methylpyrazole?
The InChIKey is NKZFPMGLHNHICQ-GJZGRUSLSA-N. The full InChI is InChI=1S/C18H21F3N2O3S/c1-3-26-14-5-6-15(9-14)27(24,25)17-7-4-12(8-16(17)18(19,20)21)13-10-22-23(2)11-13/h4,7-8,10-11,14-15H,3,5-6,9H2,1-2H3/t14-,15-/m0/s1.
What are the key properties of 4-[4-[(1S,3S)-3-ethoxycyclopentyl]sulfonyl-3-(trifluoromethyl)phenyl]-1-methylpyrazole?
4-[4-[(1S,3S)-3-ethoxycyclopentyl]sulfonyl-3-(trifluoromethyl)phenyl]-1-methylpyrazole has a molecular weight of 402.44 g/mol, XLogP of 3.84, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(1S,3S)-3-ethoxycyclopentyl]sulfonyl-3-(trifluoromethyl)phenyl]-1-methylpyrazole is sourced from PubChem (CID 90105854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).