C14H16F3NO5 — CID 90106738
[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate (PubChem CID 90106738) has the molecular formula C14H16F3NO5 and a molecular weight of 335.28 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate.
| Compound Name | [(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate |
|---|---|
| PubChem CID | 90106738 |
| Molecular Formula | C14H16F3NO5 |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] 2,2,2-trifluoro-N-phenylethanimidate |
| SMILES | C[C@@H]1O[C@H](O/C(=N/c2ccccc2)C(F)(F)F)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H16F3NO5/c1-7-9(19)10(20)11(21)12(22-7)23-13(14(15,16)17)18-8-5-3-2-4-6-8/h2-7,9-12,19-21H,1H3/b18-13+/t7-,9-,10+,11+,12+/m0/s1 |
| InChIKey | MFPBYQKWPOIPFI-MACSGRDTSA-N |
| XLogP | 1.12 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|