About S-(4-chlorophenyl) pyridine-2-carbothioate
S-(4-chlorophenyl) pyridine-2-carbothioate (PubChem CID 901068) has the molecular formula C12H8ClNOS
and a molecular weight of 249.72 g/mol. Its IUPAC name is S-(4-chlorophenyl) pyridine-2-carbothioate.
Molecular Properties
| Compound Name | S-(4-chlorophenyl) pyridine-2-carbothioate |
| PubChem CID | 901068 |
| Molecular Formula | C12H8ClNOS |
| Molecular Weight | 249.72 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | S-(4-chlorophenyl) pyridine-2-carbothioate |
| SMILES | O=C(Sc1ccc(Cl)cc1)c1ccccn1 |
| InChI | InChI=1S/C12H8ClNOS/c13-9-4-6-10(7-5-9)16-12(15)11-3-1-2-8-14-11/h1-8H |
| InChIKey | RBNAZFJCKHTGFT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.72 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-chlorophenyl) pyridine-2-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-chlorophenyl) pyridine-2-carbothioate?
The IUPAC name of S-(4-chlorophenyl) pyridine-2-carbothioate (CID 901068) is S-(4-chlorophenyl) pyridine-2-carbothioate.
What is the SMILES notation for S-(4-chlorophenyl) pyridine-2-carbothioate?
The canonical SMILES for S-(4-chlorophenyl) pyridine-2-carbothioate is O=C(Sc1ccc(Cl)cc1)c1ccccn1.
What is the InChIKey of S-(4-chlorophenyl) pyridine-2-carbothioate?
The InChIKey is RBNAZFJCKHTGFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8ClNOS/c13-9-4-6-10(7-5-9)16-12(15)11-3-1-2-8-14-11/h1-8H.
What are the key properties of S-(4-chlorophenyl) pyridine-2-carbothioate?
S-(4-chlorophenyl) pyridine-2-carbothioate has a molecular weight of 249.72 g/mol, XLogP of 3.67, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-chlorophenyl) pyridine-2-carbothioate is sourced from PubChem (CID 901068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).