C15H17F3N4O2S — CID 90107668
4-N-(6-nitrothieno[3,2-b]pyridin-7-yl)-4-N-(2,2,2-trifluoroethyl)cyclohexane-1,4-diamine (PubChem CID 90107668) has the molecular formula C15H17F3N4O2S and a molecular weight of 374.39 g/mol. Its IUPAC name is 4-N-(6-nitrothieno[3,2-b]pyridin-7-yl)-4-N-(2,2,2-trifluoroethyl)cyclohexane-1,4-diamine.
| Compound Name | 4-N-(6-nitrothieno[3,2-b]pyridin-7-yl)-4-N-(2,2,2-trifluoroethyl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 90107668 |
| Molecular Formula | C15H17F3N4O2S |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 4-N-(6-nitrothieno[3,2-b]pyridin-7-yl)-4-N-(2,2,2-trifluoroethyl)cyclohexane-1,4-diamine |
| SMILES | NC1CCC(N(CC(F)(F)F)c2c([N+](=O)[O-])cnc3ccsc23)CC1 |
| InChI | InChI=1S/C15H17F3N4O2S/c16-15(17,18)8-21(10-3-1-9(19)2-4-10)13-12(22(23)24)7-20-11-5-6-25-14(11)13/h5-7,9-10H,1-4,8,19H2 |
| InChIKey | YESVDMBUWBWKBO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|