About 4-(3-aminopropoxy)butan-1-ol;3-aminopropyl 2-aminopropanoate
4-(3-aminopropoxy)butan-1-ol;3-aminopropyl 2-aminopropanoate (PubChem CID 90107808) has the molecular formula C13H31N3O4
and a molecular weight of 293.41 g/mol. Its IUPAC name is 4-(3-aminopropoxy)butan-1-ol;3-aminopropyl 2-aminopropanoate.
Molecular Properties
| Compound Name | 4-(3-aminopropoxy)butan-1-ol;3-aminopropyl 2-aminopropanoate |
| PubChem CID | 90107808 |
| Molecular Formula | C13H31N3O4 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.23 |
| IUPAC Name | 4-(3-aminopropoxy)butan-1-ol;3-aminopropyl 2-aminopropanoate |
| SMILES | CC(N)C(=O)OCCCN.NCCCOCCCCO |
| InChI | InChI=1S/C7H17NO2.C6H14N2O2/c8-4-3-7-10-6-2-1-5-9;1-5(8)6(9)10-4-2-3-7/h9H,1-8H2;5H,2-4,7-8H2,1H3 |
| InChIKey | ONZMIOOJSZGFRW-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 133.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-aminopropoxy)butan-1-ol;3-aminopropyl 2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-aminopropoxy)butan-1-ol;3-aminopropyl 2-aminopropanoate?
The IUPAC name of 4-(3-aminopropoxy)butan-1-ol;3-aminopropyl 2-aminopropanoate (CID 90107808) is 4-(3-aminopropoxy)butan-1-ol;3-aminopropyl 2-aminopropanoate.
What is the SMILES notation for 4-(3-aminopropoxy)butan-1-ol;3-aminopropyl 2-aminopropanoate?
The canonical SMILES for 4-(3-aminopropoxy)butan-1-ol;3-aminopropyl 2-aminopropanoate is CC(N)C(=O)OCCCN.NCCCOCCCCO.
What is the InChIKey of 4-(3-aminopropoxy)butan-1-ol;3-aminopropyl 2-aminopropanoate?
The InChIKey is ONZMIOOJSZGFRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17NO2.C6H14N2O2/c8-4-3-7-10-6-2-1-5-9;1-5(8)6(9)10-4-2-3-7/h9H,1-8H2;5H,2-4,7-8H2,1H3.
What are the key properties of 4-(3-aminopropoxy)butan-1-ol;3-aminopropyl 2-aminopropanoate?
4-(3-aminopropoxy)butan-1-ol;3-aminopropyl 2-aminopropanoate has a molecular weight of 293.41 g/mol, XLogP of -0.65, 11 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-aminopropoxy)butan-1-ol;3-aminopropyl 2-aminopropanoate is sourced from PubChem (CID 90107808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).