About [8-[(6-aminothieno[3,2-b]pyridin-7-yl)amino]-1-oxaspiro[4.5]decan-8-yl]methanol
[8-[(6-aminothieno[3,2-b]pyridin-7-yl)amino]-1-oxaspiro[4.5]decan-8-yl]methanol (PubChem CID 90108058) has the molecular formula C17H23N3O2S
and a molecular weight of 333.46 g/mol. Its IUPAC name is [8-[(6-aminothieno[3,2-b]pyridin-7-yl)amino]-1-oxaspiro[4.5]decan-8-yl]methanol.
Molecular Properties
| Compound Name | [8-[(6-aminothieno[3,2-b]pyridin-7-yl)amino]-1-oxaspiro[4.5]decan-8-yl]methanol |
| PubChem CID | 90108058 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | [8-[(6-aminothieno[3,2-b]pyridin-7-yl)amino]-1-oxaspiro[4.5]decan-8-yl]methanol |
| SMILES | Nc1cnc2ccsc2c1NC1(CO)CCC2(CCCO2)CC1 |
| InChI | InChI=1S/C17H23N3O2S/c18-12-10-19-13-2-9-23-15(13)14(12)20-16(11-21)4-6-17(7-5-16)3-1-8-22-17/h2,9-10,21H,1,3-8,11,18H2,(H,19,20) |
| InChIKey | QDPATFNTUXKAQX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [8-[(6-aminothieno[3,2-b]pyridin-7-yl)amino]-1-oxaspiro[4.5]decan-8-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [8-[(6-aminothieno[3,2-b]pyridin-7-yl)amino]-1-oxaspiro[4.5]decan-8-yl]methanol?
The IUPAC name of [8-[(6-aminothieno[3,2-b]pyridin-7-yl)amino]-1-oxaspiro[4.5]decan-8-yl]methanol (CID 90108058) is [8-[(6-aminothieno[3,2-b]pyridin-7-yl)amino]-1-oxaspiro[4.5]decan-8-yl]methanol.
What is the SMILES notation for [8-[(6-aminothieno[3,2-b]pyridin-7-yl)amino]-1-oxaspiro[4.5]decan-8-yl]methanol?
The canonical SMILES for [8-[(6-aminothieno[3,2-b]pyridin-7-yl)amino]-1-oxaspiro[4.5]decan-8-yl]methanol is Nc1cnc2ccsc2c1NC1(CO)CCC2(CCCO2)CC1.
What is the InChIKey of [8-[(6-aminothieno[3,2-b]pyridin-7-yl)amino]-1-oxaspiro[4.5]decan-8-yl]methanol?
The InChIKey is QDPATFNTUXKAQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O2S/c18-12-10-19-13-2-9-23-15(13)14(12)20-16(11-21)4-6-17(7-5-16)3-1-8-22-17/h2,9-10,21H,1,3-8,11,18H2,(H,19,20).
What are the key properties of [8-[(6-aminothieno[3,2-b]pyridin-7-yl)amino]-1-oxaspiro[4.5]decan-8-yl]methanol?
[8-[(6-aminothieno[3,2-b]pyridin-7-yl)amino]-1-oxaspiro[4.5]decan-8-yl]methanol has a molecular weight of 333.46 g/mol, XLogP of 3.14, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [8-[(6-aminothieno[3,2-b]pyridin-7-yl)amino]-1-oxaspiro[4.5]decan-8-yl]methanol is sourced from PubChem (CID 90108058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).