About cyclohexyl-propyl-(2,3,4-trimethylphenyl)phosphane
cyclohexyl-propyl-(2,3,4-trimethylphenyl)phosphane (PubChem CID 90108684) has the molecular formula C18H29P
and a molecular weight of 276.40 g/mol. Its IUPAC name is cyclohexyl-propyl-(2,3,4-trimethylphenyl)phosphane.
Molecular Properties
| Compound Name | cyclohexyl-propyl-(2,3,4-trimethylphenyl)phosphane |
| PubChem CID | 90108684 |
| Molecular Formula | C18H29P |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | cyclohexyl-propyl-(2,3,4-trimethylphenyl)phosphane |
| SMILES | CCCP(c1ccc(C)c(C)c1C)C1CCCCC1 |
| InChI | InChI=1S/C18H29P/c1-5-13-19(17-9-7-6-8-10-17)18-12-11-14(2)15(3)16(18)4/h11-12,17H,5-10,13H2,1-4H3 |
| InChIKey | IQZZTVFZNFLCET-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl-propyl-(2,3,4-trimethylphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-propyl-(2,3,4-trimethylphenyl)phosphane?
The IUPAC name of cyclohexyl-propyl-(2,3,4-trimethylphenyl)phosphane (CID 90108684) is cyclohexyl-propyl-(2,3,4-trimethylphenyl)phosphane.
What is the SMILES notation for cyclohexyl-propyl-(2,3,4-trimethylphenyl)phosphane?
The canonical SMILES for cyclohexyl-propyl-(2,3,4-trimethylphenyl)phosphane is CCCP(c1ccc(C)c(C)c1C)C1CCCCC1.
What is the InChIKey of cyclohexyl-propyl-(2,3,4-trimethylphenyl)phosphane?
The InChIKey is IQZZTVFZNFLCET-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29P/c1-5-13-19(17-9-7-6-8-10-17)18-12-11-14(2)15(3)16(18)4/h11-12,17H,5-10,13H2,1-4H3.
What are the key properties of cyclohexyl-propyl-(2,3,4-trimethylphenyl)phosphane?
cyclohexyl-propyl-(2,3,4-trimethylphenyl)phosphane has a molecular weight of 276.40 g/mol, XLogP of 5.46, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-propyl-(2,3,4-trimethylphenyl)phosphane is sourced from PubChem (CID 90108684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).