About 1,1'-biphenyl;cyclooctanone
1,1'-biphenyl;cyclooctanone (PubChem CID 90108767) has the molecular formula C20H24O
and a molecular weight of 280.41 g/mol. Its IUPAC name is 1,1'-biphenyl;cyclooctanone.
Molecular Properties
| Compound Name | 1,1'-biphenyl;cyclooctanone |
| PubChem CID | 90108767 |
| Molecular Formula | C20H24O |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 1,1'-biphenyl;cyclooctanone |
| SMILES | O=C1CCCCCCC1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C8H14O/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;9-8-6-4-2-1-3-5-7-8/h1-10H;1-7H2 |
| InChIKey | CJENEHPGASDUTK-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,1'-biphenyl;cyclooctanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;cyclooctanone?
The IUPAC name of 1,1'-biphenyl;cyclooctanone (CID 90108767) is 1,1'-biphenyl;cyclooctanone.
What is the SMILES notation for 1,1'-biphenyl;cyclooctanone?
The canonical SMILES for 1,1'-biphenyl;cyclooctanone is O=C1CCCCCCC1.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;cyclooctanone?
The InChIKey is CJENEHPGASDUTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C8H14O/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;9-8-6-4-2-1-3-5-7-8/h1-10H;1-7H2.
What are the key properties of 1,1'-biphenyl;cyclooctanone?
1,1'-biphenyl;cyclooctanone has a molecular weight of 280.41 g/mol, XLogP of 5.65, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;cyclooctanone is sourced from PubChem (CID 90108767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).