C42H54P2 — CID 90109663
[1-bis(2,3,4-trimethylphenyl)phosphanylcyclohexyl]-bis(2,3,4-trimethylphenyl)phosphane (PubChem CID 90109663) has the molecular formula C42H54P2 and a molecular weight of 620.84 g/mol. Its IUPAC name is [1-bis(2,3,4-trimethylphenyl)phosphanylcyclohexyl]-bis(2,3,4-trimethylphenyl)phosphane.
| Compound Name | [1-bis(2,3,4-trimethylphenyl)phosphanylcyclohexyl]-bis(2,3,4-trimethylphenyl)phosphane |
|---|---|
| PubChem CID | 90109663 |
| Molecular Formula | C42H54P2 |
| Molecular Weight | 620.84 g/mol |
| Exact Mass | 620.37 |
| IUPAC Name | [1-bis(2,3,4-trimethylphenyl)phosphanylcyclohexyl]-bis(2,3,4-trimethylphenyl)phosphane |
| SMILES | Cc1ccc(P(c2ccc(C)c(C)c2C)C2(P(c3ccc(C)c(C)c3C)c3ccc(C)c(C)c3C)CCCCC2)c(C)c1C |
| InChI | InChI=1S/C42H54P2/c1-26-16-20-38(34(9)30(26)5)43(39-21-17-27(2)31(6)35(39)10)42(24-14-13-15-25-42)44(40-22-18-28(3)32(7)36(40)11)41-23-19-29(4)33(8)37(41)12/h16-23H,13-15,24-25H2,1-12H3 |
| InChIKey | RYNKAXRNNQHIQS-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.84 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|