About 3,4-bis(methylsulfanyl)piperazine-2,6-dione
3,4-bis(methylsulfanyl)piperazine-2,6-dione (PubChem CID 90109769) has the molecular formula C6H10N2O2S2
and a molecular weight of 206.29 g/mol. Its IUPAC name is 3,4-bis(methylsulfanyl)piperazine-2,6-dione.
Molecular Properties
| Compound Name | 3,4-bis(methylsulfanyl)piperazine-2,6-dione |
| PubChem CID | 90109769 |
| Molecular Formula | C6H10N2O2S2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.02 |
| IUPAC Name | 3,4-bis(methylsulfanyl)piperazine-2,6-dione |
| SMILES | CSC1C(=O)NC(=O)CN1SC |
| InChI | InChI=1S/C6H10N2O2S2/c1-11-6-5(10)7-4(9)3-8(6)12-2/h6H,3H2,1-2H3,(H,7,9,10) |
| InChIKey | QSGNMCXCNZEWRB-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,4-bis(methylsulfanyl)piperazine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(methylsulfanyl)piperazine-2,6-dione?
The IUPAC name of 3,4-bis(methylsulfanyl)piperazine-2,6-dione (CID 90109769) is 3,4-bis(methylsulfanyl)piperazine-2,6-dione.
What is the SMILES notation for 3,4-bis(methylsulfanyl)piperazine-2,6-dione?
The canonical SMILES for 3,4-bis(methylsulfanyl)piperazine-2,6-dione is CSC1C(=O)NC(=O)CN1SC.
What is the InChIKey of 3,4-bis(methylsulfanyl)piperazine-2,6-dione?
The InChIKey is QSGNMCXCNZEWRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2S2/c1-11-6-5(10)7-4(9)3-8(6)12-2/h6H,3H2,1-2H3,(H,7,9,10).
What are the key properties of 3,4-bis(methylsulfanyl)piperazine-2,6-dione?
3,4-bis(methylsulfanyl)piperazine-2,6-dione has a molecular weight of 206.29 g/mol, XLogP of -0.09, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(methylsulfanyl)piperazine-2,6-dione is sourced from PubChem (CID 90109769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).