About 2,2,4-triacetylcyclohexane-1,3-dione
2,2,4-triacetylcyclohexane-1,3-dione (PubChem CID 90110111) has the molecular formula C12H14O5
and a molecular weight of 238.24 g/mol. Its IUPAC name is 2,2,4-triacetylcyclohexane-1,3-dione.
Molecular Properties
| Compound Name | 2,2,4-triacetylcyclohexane-1,3-dione |
| PubChem CID | 90110111 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 2,2,4-triacetylcyclohexane-1,3-dione |
| SMILES | CC(=O)C1CCC(=O)C(C(C)=O)(C(C)=O)C1=O |
| InChI | InChI=1S/C12H14O5/c1-6(13)9-4-5-10(16)12(7(2)14,8(3)15)11(9)17/h9H,4-5H2,1-3H3 |
| InChIKey | KQADYKHCUHQMEA-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2,2,4-triacetylcyclohexane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,4-triacetylcyclohexane-1,3-dione?
The IUPAC name of 2,2,4-triacetylcyclohexane-1,3-dione (CID 90110111) is 2,2,4-triacetylcyclohexane-1,3-dione.
What is the SMILES notation for 2,2,4-triacetylcyclohexane-1,3-dione?
The canonical SMILES for 2,2,4-triacetylcyclohexane-1,3-dione is CC(=O)C1CCC(=O)C(C(C)=O)(C(C)=O)C1=O.
What is the InChIKey of 2,2,4-triacetylcyclohexane-1,3-dione?
The InChIKey is KQADYKHCUHQMEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O5/c1-6(13)9-4-5-10(16)12(7(2)14,8(3)15)11(9)17/h9H,4-5H2,1-3H3.
What are the key properties of 2,2,4-triacetylcyclohexane-1,3-dione?
2,2,4-triacetylcyclohexane-1,3-dione has a molecular weight of 238.24 g/mol, XLogP of 0.29, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,4-triacetylcyclohexane-1,3-dione is sourced from PubChem (CID 90110111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).