C13H20O3 — CID 90110539
2-ethoxy-4-ethyl-2,3,4,6,7,8-hexahydrochromen-5-one (PubChem CID 90110539) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-ethoxy-4-ethyl-2,3,4,6,7,8-hexahydrochromen-5-one.
| Compound Name | 2-ethoxy-4-ethyl-2,3,4,6,7,8-hexahydrochromen-5-one |
|---|---|
| PubChem CID | 90110539 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 2-ethoxy-4-ethyl-2,3,4,6,7,8-hexahydrochromen-5-one |
| SMILES | CCOC1CC(CC)C2=C(CCCC2=O)O1 |
| InChI | InChI=1S/C13H20O3/c1-3-9-8-12(15-4-2)16-11-7-5-6-10(14)13(9)11/h9,12H,3-8H2,1-2H3 |
| InChIKey | HKBSQNNPRJZCDY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |