C39H50P2 — CID 90110540
1-bis(2,3,4-trimethylphenyl)phosphanylpropyl-bis(2,3,4-trimethylphenyl)phosphane (PubChem CID 90110540) has the molecular formula C39H50P2 and a molecular weight of 580.78 g/mol. Its IUPAC name is 1-bis(2,3,4-trimethylphenyl)phosphanylpropyl-bis(2,3,4-trimethylphenyl)phosphane.
| Compound Name | 1-bis(2,3,4-trimethylphenyl)phosphanylpropyl-bis(2,3,4-trimethylphenyl)phosphane |
|---|---|
| PubChem CID | 90110540 |
| Molecular Formula | C39H50P2 |
| Molecular Weight | 580.78 g/mol |
| Exact Mass | 580.34 |
| IUPAC Name | 1-bis(2,3,4-trimethylphenyl)phosphanylpropyl-bis(2,3,4-trimethylphenyl)phosphane |
| SMILES | CCC(P(c1ccc(C)c(C)c1C)c1ccc(C)c(C)c1C)P(c1ccc(C)c(C)c1C)c1ccc(C)c(C)c1C |
| InChI | InChI=1S/C39H50P2/c1-14-39(40(35-19-15-23(2)27(6)31(35)10)36-20-16-24(3)28(7)32(36)11)41(37-21-17-25(4)29(8)33(37)12)38-22-18-26(5)30(9)34(38)13/h15-22,39H,14H2,1-13H3 |
| InChIKey | UIQSDJGRUZHVDV-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.78 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|