C12H16O5 — CID 90110855
3,3-diacetyloctane-2,4,7-trione (PubChem CID 90110855) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is 3,3-diacetyloctane-2,4,7-trione.
| Compound Name | 3,3-diacetyloctane-2,4,7-trione |
|---|---|
| PubChem CID | 90110855 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 3,3-diacetyloctane-2,4,7-trione |
| SMILES | CC(=O)CCC(=O)C(C(C)=O)(C(C)=O)C(C)=O |
| InChI | InChI=1S/C12H16O5/c1-7(13)5-6-11(17)12(8(2)14,9(3)15)10(4)16/h5-6H2,1-4H3 |
| InChIKey | VOGQEAWNBRLSSF-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|