About 3-(1,3-benzoxazol-2-yl)-5-(1-ethylindazol-5-yl)-1H-pyrazolo[1,5-a]pyrimidin-7-one
3-(1,3-benzoxazol-2-yl)-5-(1-ethylindazol-5-yl)-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 90111435) has the molecular formula C22H16N6O2
and a molecular weight of 396.41 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-yl)-5-(1-ethylindazol-5-yl)-1H-pyrazolo[1,5-a]pyrimidin-7-one.
Molecular Properties
| Compound Name | 3-(1,3-benzoxazol-2-yl)-5-(1-ethylindazol-5-yl)-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| PubChem CID | 90111435 |
| Molecular Formula | C22H16N6O2 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 3-(1,3-benzoxazol-2-yl)-5-(1-ethylindazol-5-yl)-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | CCn1ncc2cc(-c3cc(=O)n4[nH]cc(-c5nc6ccccc6o5)c4n3)ccc21 |
| InChI | InChI=1S/C22H16N6O2/c1-2-27-18-8-7-13(9-14(18)11-23-27)17-10-20(29)28-21(25-17)15(12-24-28)22-26-16-5-3-4-6-19(16)30-22/h3-12,24H,2H2,1H3 |
| InChIKey | XIVFGJBCLQGLSA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 94.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-(1,3-benzoxazol-2-yl)-5-(1-ethylindazol-5-yl)-1H-pyrazolo[1,5-a]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-benzoxazol-2-yl)-5-(1-ethylindazol-5-yl)-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The IUPAC name of 3-(1,3-benzoxazol-2-yl)-5-(1-ethylindazol-5-yl)-1H-pyrazolo[1,5-a]pyrimidin-7-one (CID 90111435) is 3-(1,3-benzoxazol-2-yl)-5-(1-ethylindazol-5-yl)-1H-pyrazolo[1,5-a]pyrimidin-7-one.
What is the SMILES notation for 3-(1,3-benzoxazol-2-yl)-5-(1-ethylindazol-5-yl)-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The canonical SMILES for 3-(1,3-benzoxazol-2-yl)-5-(1-ethylindazol-5-yl)-1H-pyrazolo[1,5-a]pyrimidin-7-one is CCn1ncc2cc(-c3cc(=O)n4[nH]cc(-c5nc6ccccc6o5)c4n3)ccc21.
What is the InChIKey of 3-(1,3-benzoxazol-2-yl)-5-(1-ethylindazol-5-yl)-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The InChIKey is XIVFGJBCLQGLSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N6O2/c1-2-27-18-8-7-13(9-14(18)11-23-27)17-10-20(29)28-21(25-17)15(12-24-28)22-26-16-5-3-4-6-19(16)30-22/h3-12,24H,2H2,1H3.
What are the key properties of 3-(1,3-benzoxazol-2-yl)-5-(1-ethylindazol-5-yl)-1H-pyrazolo[1,5-a]pyrimidin-7-one?
3-(1,3-benzoxazol-2-yl)-5-(1-ethylindazol-5-yl)-1H-pyrazolo[1,5-a]pyrimidin-7-one has a molecular weight of 396.41 g/mol, XLogP of 3.87, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzoxazol-2-yl)-5-(1-ethylindazol-5-yl)-1H-pyrazolo[1,5-a]pyrimidin-7-one is sourced from PubChem (CID 90111435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).