C9H12O2 — CID 90111544
2,3,4,4a,6,8a-hexahydrochromen-5-one (PubChem CID 90111544) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 2,3,4,4a,6,8a-hexahydrochromen-5-one.
| Compound Name | 2,3,4,4a,6,8a-hexahydrochromen-5-one |
|---|---|
| PubChem CID | 90111544 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 2,3,4,4a,6,8a-hexahydrochromen-5-one |
| SMILES | O=C1CC=CC2OCCCC12 |
| InChI | InChI=1S/C9H12O2/c10-8-4-1-5-9-7(8)3-2-6-11-9/h1,5,7,9H,2-4,6H2 |
| InChIKey | SVZONIKRNMPRCB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|