C15H24O3 — CID 90111731
2-ethoxy-4,4,7,7-tetramethyl-2,3,6,8-tetrahydrochromen-5-one (PubChem CID 90111731) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is 2-ethoxy-4,4,7,7-tetramethyl-2,3,6,8-tetrahydrochromen-5-one.
| Compound Name | 2-ethoxy-4,4,7,7-tetramethyl-2,3,6,8-tetrahydrochromen-5-one |
|---|---|
| PubChem CID | 90111731 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 2-ethoxy-4,4,7,7-tetramethyl-2,3,6,8-tetrahydrochromen-5-one |
| SMILES | CCOC1CC(C)(C)C2=C(CC(C)(C)CC2=O)O1 |
| InChI | InChI=1S/C15H24O3/c1-6-17-12-9-15(4,5)13-10(16)7-14(2,3)8-11(13)18-12/h12H,6-9H2,1-5H3 |
| InChIKey | HRZYFVPINMWGRW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |