C12H10F5N5 — CID 90111788
6-(2-fluoropropan-2-yl)-2-N-(2,3,5,6-tetrafluorophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 90111788) has the molecular formula C12H10F5N5 and a molecular weight of 319.24 g/mol. Its IUPAC name is 6-(2-fluoropropan-2-yl)-2-N-(2,3,5,6-tetrafluorophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2-fluoropropan-2-yl)-2-N-(2,3,5,6-tetrafluorophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 90111788 |
| Molecular Formula | C12H10F5N5 |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 6-(2-fluoropropan-2-yl)-2-N-(2,3,5,6-tetrafluorophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)(F)c1nc(N)nc(Nc2c(F)c(F)cc(F)c2F)n1 |
| InChI | InChI=1S/C12H10F5N5/c1-12(2,17)9-20-10(18)22-11(21-9)19-8-6(15)4(13)3-5(14)7(8)16/h3H,1-2H3,(H3,18,19,20,21,22) |
| InChIKey | PYRHIZYKELMOJU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|