C38H60O9S — CID 90111817
[(2R,3S,4S,5R,6R)-4,5-di(hexanoyloxy)-6-(hexanoyloxymethyl)-2-phenylsulfanyloxan-3-yl] octanoate (PubChem CID 90111817) has the molecular formula C38H60O9S and a molecular weight of 692.96 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-4,5-di(hexanoyloxy)-6-(hexanoyloxymethyl)-2-phenylsulfanyloxan-3-yl] octanoate.
| Compound Name | [(2R,3S,4S,5R,6R)-4,5-di(hexanoyloxy)-6-(hexanoyloxymethyl)-2-phenylsulfanyloxan-3-yl] octanoate |
|---|---|
| PubChem CID | 90111817 |
| Molecular Formula | C38H60O9S |
| Molecular Weight | 692.96 g/mol |
| Exact Mass | 692.40 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-4,5-di(hexanoyloxy)-6-(hexanoyloxymethyl)-2-phenylsulfanyloxan-3-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@H]1[C@@H](OC(=O)CCCCC)[C@H](OC(=O)CCCCC)[C@@H](COC(=O)CCCCC)O[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C38H60O9S/c1-5-9-13-14-21-27-34(42)47-37-36(46-33(41)26-18-12-8-4)35(45-32(40)25-17-11-7-3)30(28-43-31(39)24-16-10-6-2)44-38(37)48-29-22-19-15-20-23-29/h15,19-20,22-23,30,35-38H,5-14,16-18,21,24-28H2,1-4H3/t30-,35-,36+,37+,38-/m1/s1 |
| InChIKey | RRRKIYWRLZJKPS-JNMVICHLSA-N |
| XLogP | 8.88 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.96 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|