C20H30O6S — CID 90112190
[(2R,3S,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-phenylsulfanyloxan-3-yl] octanoate (PubChem CID 90112190) has the molecular formula C20H30O6S and a molecular weight of 398.52 g/mol. Its IUPAC name is [(2R,3S,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-phenylsulfanyloxan-3-yl] octanoate.
| Compound Name | [(2R,3S,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-phenylsulfanyloxan-3-yl] octanoate |
|---|---|
| PubChem CID | 90112190 |
| Molecular Formula | C20H30O6S |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | [(2R,3S,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-phenylsulfanyloxan-3-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C20H30O6S/c1-2-3-4-5-9-12-16(22)26-19-18(24)17(23)15(13-21)25-20(19)27-14-10-7-6-8-11-14/h6-8,10-11,15,17-21,23-24H,2-5,9,12-13H2,1H3/t15-,17-,18+,19+,20-/m1/s1 |
| InChIKey | CSUGMZCGQWCWMP-LFZDHENXSA-N |
| XLogP | 2.49 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|