C24H31BFNO3 — CID 90112289
4-tert-butyl-N-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]benzamide (PubChem CID 90112289) has the molecular formula C24H31BFNO3 and a molecular weight of 411.33 g/mol. Its IUPAC name is 4-tert-butyl-N-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]benzamide.
| Compound Name | 4-tert-butyl-N-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 90112289 |
| Molecular Formula | C24H31BFNO3 |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 4-tert-butyl-N-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NCc2ccc(B3OC(C)(C)C(C)(C)O3)cc2F)cc1 |
| InChI | InChI=1S/C24H31BFNO3/c1-22(2,3)18-11-8-16(9-12-18)21(28)27-15-17-10-13-19(14-20(17)26)25-29-23(4,5)24(6,7)30-25/h8-14H,15H2,1-7H3,(H,27,28) |
| InChIKey | DKOSWVRTGFUOMJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|