C16H26O3 — CID 90112481
2-butoxy-4-propan-2-yl-2,3,4,6,7,8-hexahydrochromen-5-one (PubChem CID 90112481) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 2-butoxy-4-propan-2-yl-2,3,4,6,7,8-hexahydrochromen-5-one.
| Compound Name | 2-butoxy-4-propan-2-yl-2,3,4,6,7,8-hexahydrochromen-5-one |
|---|---|
| PubChem CID | 90112481 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 2-butoxy-4-propan-2-yl-2,3,4,6,7,8-hexahydrochromen-5-one |
| SMILES | CCCCOC1CC(C(C)C)C2=C(CCCC2=O)O1 |
| InChI | InChI=1S/C16H26O3/c1-4-5-9-18-15-10-12(11(2)3)16-13(17)7-6-8-14(16)19-15/h11-12,15H,4-10H2,1-3H3 |
| InChIKey | PELQMQYSSSVZQP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|