C19H17ClF3N5O3 — CID 90112509
5-[4-chloro-3-(2,2,2-trifluoroethoxy)phenyl]-N-[1-(dimethylamino)ethylidene]-7-oxo-1H-pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 90112509) has the molecular formula C19H17ClF3N5O3 and a molecular weight of 455.82 g/mol. Its IUPAC name is 5-[4-chloro-3-(2,2,2-trifluoroethoxy)phenyl]-N-[1-(dimethylamino)ethylidene]-7-oxo-1H-pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 5-[4-chloro-3-(2,2,2-trifluoroethoxy)phenyl]-N-[1-(dimethylamino)ethylidene]-7-oxo-1H-pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 90112509 |
| Molecular Formula | C19H17ClF3N5O3 |
| Molecular Weight | 455.82 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | 5-[4-chloro-3-(2,2,2-trifluoroethoxy)phenyl]-N-[1-(dimethylamino)ethylidene]-7-oxo-1H-pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | C/C(=N\C(=O)c1c[nH]n2c(=O)cc(-c3ccc(Cl)c(OCC(F)(F)F)c3)nc12)N(C)C |
| InChI | InChI=1S/C19H17ClF3N5O3/c1-10(27(2)3)25-18(30)12-8-24-28-16(29)7-14(26-17(12)28)11-4-5-13(20)15(6-11)31-9-19(21,22)23/h4-8,24H,9H2,1-3H3/b25-10+ |
| InChIKey | JGKHLLGLDAAOQT-KIBLKLHPSA-N |
| XLogP | 3.40 |
| TPSA | 92.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.82 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|