About 5-bromo-3,4-dichloropyridin-2-amine
5-bromo-3,4-dichloropyridin-2-amine (PubChem CID 90112572) has the molecular formula C5H3BrCl2N2
and a molecular weight of 241.90 g/mol. Its IUPAC name is 5-bromo-3,4-dichloropyridin-2-amine.
Molecular Properties
| Compound Name | 5-bromo-3,4-dichloropyridin-2-amine |
| PubChem CID | 90112572 |
| Molecular Formula | C5H3BrCl2N2 |
| Molecular Weight | 241.90 g/mol |
| Exact Mass | 239.89 |
| IUPAC Name | 5-bromo-3,4-dichloropyridin-2-amine |
| SMILES | Nc1ncc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C5H3BrCl2N2/c6-2-1-10-5(9)4(8)3(2)7/h1H,(H2,9,10) |
| InChIKey | BBYPUQDFQKZHNW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.90 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-3,4-dichloropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3,4-dichloropyridin-2-amine?
The IUPAC name of 5-bromo-3,4-dichloropyridin-2-amine (CID 90112572) is 5-bromo-3,4-dichloropyridin-2-amine.
What is the SMILES notation for 5-bromo-3,4-dichloropyridin-2-amine?
The canonical SMILES for 5-bromo-3,4-dichloropyridin-2-amine is Nc1ncc(Br)c(Cl)c1Cl.
What is the InChIKey of 5-bromo-3,4-dichloropyridin-2-amine?
The InChIKey is BBYPUQDFQKZHNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3BrCl2N2/c6-2-1-10-5(9)4(8)3(2)7/h1H,(H2,9,10).
What are the key properties of 5-bromo-3,4-dichloropyridin-2-amine?
5-bromo-3,4-dichloropyridin-2-amine has a molecular weight of 241.90 g/mol, XLogP of 2.73, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3,4-dichloropyridin-2-amine is sourced from PubChem (CID 90112572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).